| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | API >> Hormone and endocrine-regulating drugs >> Pancreatic hormones and other blood sugar regulating drugs |
|---|---|
| Name | Glymidine Sodium |
| Synonyms | Sodium [3-(2-Methoxyethoxy)Phenyl]Sulfonyl-Pyrimidin-2-Yl-Azanide; Sodium [3-(2-Methoxyethoxy)Phenyl]Sulfonyl-(2-Pyrimidinyl)Azanide; (N-(5-(2-Methoxyethoxy)-2-Pyrimidinyl)Benzenesulfonamido) Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N3NaO4S |
| Molecular Weight | 331.32 |
| CAS Registry Number | 3459-20-9 |
| EINECS | 222-399-2 |
| SMILES | C1=C(OCCOC)C=CC=C1[S](=O)(=O)[N-]C2=NC=CC=N2.[Na+] |
| InChI | 1S/C13H14N3O4S.Na/c1-19-8-9-20-11-4-2-5-12(10-11)21(17,18)16-13-14-6-3-7-15-13;/h2-7,10H,8-9H2,1H3;/q-1;+1 |
| InChIKey | HCLFWAHLVGHDOL-UHFFFAOYSA-N |
| Market Analysis Reports |