|
CAS#: 34728-60-4 Product: methacrylate, polymer with ethyl acrylate, (methacrylic acid, 2-(diethylamino)ethyl ester) No suppilers available for the product. |
| Name | methacrylate, polymer with ethyl acrylate, (methacrylic acid, 2-(diethylamino)ethyl ester) |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2-Diethylaminoethyl Ester; 2-Methylprop-2-Enoic Acid Methyl Ester; Prop-2-Enoic Acid Ethyl Ester; Acrylic Acid Ethyl Ester; 2-Methylacrylic Acid 2-Diethylaminoethyl Ester; 2-Methylacrylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H35NO6 |
| Molecular Weight | 385.50 |
| CAS Registry Number | 34728-60-4 |
| SMILES | C(OC(=O)C(=C)C)CN(CC)CC.CC(C(OC)=O)=C.C(OC(=O)C=C)C |
| InChI | 1S/C10H19NO2.2C5H8O2/c1-5-11(6-2)7-8-13-10(12)9(3)4;1-4(2)5(6)7-3;1-3-5(6)7-4-2/h3,5-8H2,1-2,4H3;1H2,2-3H3;3H,1,4H2,2H3 |
| InChIKey | IBGDOYIDDXDLEP-UHFFFAOYSA-N |
| Boiling point | 239.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 81°C (Cal.) |
| Market Analysis Reports |