| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 2,3-Dichloro-1,4-Dimethylbenzene |
|---|---|
| Synonyms | 2,3-Dichloro-1,4-Dimethyl-Benzene; Nsc145852; Benzene, 2,3-Dichloro-1,4-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8Cl2 |
| Molecular Weight | 175.06 |
| CAS Registry Number | 34840-79-4 |
| SMILES | C1=C(C(=C(C(=C1)C)Cl)Cl)C |
| InChI | 1S/C8H8Cl2/c1-5-3-4-6(2)8(10)7(5)9/h3-4H,1-2H3 |
| InChIKey | UGHIQYNKFXEQPU-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.739°C at 760 mmHg (Cal.) |
| Flash point | 89.722°C (Cal.) |
| (1) | Chang-Tao Hsiao and Shih-Yuan Lu. Morphological modulation of optoelectronic properties of organic–inorganic nanohybrids prepared with a one-step co-fed chemical vapor depositionpolymerization process, J. Mater. Chem., 2009, 19, 6766. |
|---|---|
| Market Analysis Reports |