|
CAS#: 3495-42-9 Product: 5,6,7,8-Tetrachloroquinoxaline No suppilers available for the product. |
| Name | 5,6,7,8-Tetrachloroquinoxaline |
|---|---|
| Synonyms | 5-23-07-00146 (Beilstein Handbook Reference); Brn 0913759; Chlorquinox |
| Molecular Structure | ![]() |
| Molecular Formula | C8H2Cl4N2 |
| Molecular Weight | 267.93 |
| CAS Registry Number | 3495-42-9 |
| SMILES | C2=CN=C1C(=C(Cl)C(=C(Cl)C1=N2)Cl)Cl |
| InChI | 1S/C8H2Cl4N2/c9-3-4(10)6(12)8-7(5(3)11)13-1-2-14-8/h1-2H |
| InChIKey | NHTGQOXRZFUGJX-UHFFFAOYSA-N |
| Density | 1.698g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.11°C at 760 mmHg (Cal.) |
| Flash point | 214.979°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |