| LGC Standards | UK | |||
|---|---|---|---|---|
![]() |
+44 (20) 8943-8480 | |||
![]() |
uksales@lgcstandards.com | |||
| Chemical manufacturer since 2007 | ||||
| Name | 1-Chloro-4-[1-(4-Chlorophenyl)Ethyl]Benzene |
|---|---|
| Synonyms | Benzene, 1,1'-Ethylidenebis(4-Chloro-; Dimic; Ethane, 1,1-Bis(P-Chlorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12Cl2 |
| Molecular Weight | 251.15 |
| CAS Registry Number | 3547-04-4 |
| SMILES | C1=C(C=CC(=C1)Cl)C(C)C2=CC=C(C=C2)Cl |
| InChI | 1S/C14H12Cl2/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12/h2-10H,1H3 |
| InChIKey | KTEARTXATWOYDB-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.539°C at 760 mmHg (Cal.) |
| Flash point | 143.615°C (Cal.) |
| (1) | Md. Abdul Jabbar, Hisashi Shimakoshi and Yoshio Hisaeda. Enhanced reactivity of hydrophobic vitamin B towards the dechlorination of DDT in ionic liquid, Chem. Commun., 2007, 0, 1653. |
|---|---|
| Market Analysis Reports |