| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Synchem OHG | Germany | |||
|---|---|---|---|---|
![]() |
+49 (5662) 40873-0 | |||
![]() |
info@synchem.de | |||
| Chemical manufacturer | ||||
| Name | 9-Amino-6-Chloro-2-Methoxyacridine |
|---|---|
| Synonyms | 6-Chloro-2-Methoxy-Acridin-9-Amine; 6-Chloro-2-Methoxy-9-Acridinamine; (6-Chloro-2-Methoxy-Acridin-9-Yl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 |
| CAS Registry Number | 3548-09-2 |
| SMILES | C1=C(OC)C=CC2=C1C(=C3C(=N2)C=C(Cl)C=C3)N |
| InChI | 1S/C14H11ClN2O/c1-18-9-3-5-12-11(7-9)14(16)10-4-2-8(15)6-13(10)17-12/h2-7H,1H3,(H2,16,17) |
| InChIKey | IHHSSHCBRVYGJX-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.144°C at 760 mmHg (Cal.) |
| Flash point | 241.158°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Natalia Busto, Begoña García, José M. Leal, Jorge F. Gaspar, Célia Martins, Alessia Boggioni and Fernando Secco. ACMA (9-amino-6-chloro-2-methoxy acridine) forms three complexes in the presence of DNA, Phys. Chem. Chem. Phys., 2011, 13, 19534. |
|---|---|
| Market Analysis Reports |