| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Cyclic hydrocarbon |
|---|---|
| Name | Perfluorocyclohexane |
| Synonyms | Cyclohexane, Dodecafluoro-; Dodecafluorocyclohexane; Nsc68382 |
| Molecular Structure | ![]() |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.05 |
| CAS Registry Number | 355-68-0 |
| EINECS | 206-591-3 |
| SMILES | FC1(C(C(C(F)(F)C(C1(F)F)(F)F)(F)F)(F)F)F |
| InChI | 1S/C6F12/c7-1(8)2(9,10)4(13,14)6(17,18)5(15,16)3(1,11)12 |
| InChIKey | RKIMETXDACNTIE-UHFFFAOYSA-N |
| Density | 1.723g/cm3 (Cal.) |
|---|---|
| Melting point | 51°C (Expl.) |
| Boiling point | 55.447°C at 760 mmHg (Cal.) |
| 59-60°C (Expl.) | |
| Flash point | -3.213°C (Cal.) |
| Refractive index | 1.2685 (Expl.) |
| SDS | Available |
|---|---|
| (1) | Stephen J. Cowling, Alan W. Hall and John W. Goodby. Fluorocarbon and hydrocarbon end groups: effects on mesomorphism and physical properties of smectic liquid crystals, J. Mater. Chem., 2011, 21, 9031. |
|---|---|
| Market Analysis Reports |