| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Creative Peptides | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink massive supplier since 2016 | ||||
| IRIS Biotech GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (9231) 961-973 | |||
![]() |
info@iris-biotech.de | |||
| Chemical manufacturer since 1788 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tyrosine derivatives |
|---|---|
| Name | 4-Nitrophenyl N-[(benzyloxy)carbonyl]tyrosinate |
| Synonyms | 3-(4-Hydroxyphenyl)-2-[[Oxo-(Phenylmethoxy)Methyl]Amino]Propanoic Acid (4-Nitrophenyl) Ester; 2-(Benzyloxycarbonylamino)-3-(4-Hydroxyphenyl)Propionic Acid (4-Nitrophenyl) Ester; 4-Nitrophenyl N-((Benzyloxy)Carbonyl)-L-Tyrosinate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 |
| CAS Registry Number | 3556-56-7 |
| EINECS | 222-617-6 |
| SMILES | C1=CC(=CC=C1CC(C(OC2=CC=C([N+](=O)[O-])C=C2)=O)NC(OCC3=CC=CC=C3)=O)O |
| InChI | 1S/C23H20N2O7/c26-19-10-6-16(7-11-19)14-21(24-23(28)31-15-17-4-2-1-3-5-17)22(27)32-20-12-8-18(9-13-20)25(29)30/h1-13,21,26H,14-15H2,(H,24,28) |
| InChIKey | WUHIFOXZYIQZFP-UHFFFAOYSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 672.356°C at 760 mmHg (Cal.) |
| Flash point | 360.428°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |