| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Florida Center for Heterocyclic Compounds | USA | |||
|---|---|---|---|---|
![]() |
+1 (352) 392-0554 | |||
![]() |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4H-Benzo[E][1,2,4]Thiadiazine 1,1-Dioxide |
|---|---|
| Synonyms | 2H-1,2,4-Benzothiadiazine, 1,1-Dioxide; 2H-1,2,4-Benzothiadiazine-1,1-Dioxide; 2H-1,2,4-Benzotiodiazina 1,1-Diossido [Italian] |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 |
| CAS Registry Number | 359-85-3 |
| SMILES | C2=C1[S](N=CNC1=CC=C2)(=O)=O |
| InChI | 1S/C7H6N2O2S/c10-12(11)7-4-2-1-3-6(7)8-5-9-12/h1-5H,(H,8,9) |
| InChIKey | BBNGVMNBBLPZIR-UHFFFAOYSA-N |
| Density | 1.546g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.08°C at 760 mmHg (Cal.) |
| Flash point | 183.666°C (Cal.) |
| (1) | Andrew J. A. Watson, Aoife C. Maxwell and Jonathan M. J. Williams. Ruthenium-catalysed oxidative synthesis of heterocycles from alcohols, Org. Biomol. Chem., 2012, 10, 240. |
|---|---|
| Market Analysis Reports |