| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Difluorodiphenylmethane |
|---|---|
| Synonyms | (Difluoro-Phenyl-Methyl)Benzene; Benzene, 1,1'-(Difluoromethylene)Bis-; Difluoro Diphenyl Methane |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10F2 |
| Molecular Weight | 204.22 |
| CAS Registry Number | 360-11-2 |
| SMILES | C1=CC=CC(=C1)C(C2=CC=CC=C2)(F)F |
| InChI | 1S/C13H10F2/c14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | LVTDRHCAWKTYCQ-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Melting point | 29-30°C (Expl.) |
| Boiling point | 267.964°C at 760 mmHg (Cal.) |
| 156-160°C (Expl.) | |
| Flash point | 110°C (Expl.) |
| 95.792°C (Cal.) | |
| Refractive index | 1.536 (Expl.) |
| SDS | Available |
|---|---|
| (1) | Jun Terao, Misaki Nakamura and Nobuaki Kambe. Non-catalytic conversion of C–F bonds of benzotrifluorides to C–C bonds using organoaluminium reagents, Chem. Commun., 2009, 6011. |
|---|---|
| Market Analysis Reports |