| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | API >> Circulatory system medication >> Prevention and treatment of angina pectoris |
|---|---|
| Name | Cloridarol |
| Synonyms | Benzofuran-2-Yl-(4-Chlorophenyl)Methanol; 2-Benzofuranyl-(4-Chlorophenyl)Methanol; Clobenfurol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11ClO2 |
| Molecular Weight | 258.70 |
| CAS Registry Number | 3611-72-1 |
| EINECS | 222-780-3 |
| SMILES | C2=C(C(C1=CC=C(C=C1)Cl)O)OC3=C2C=CC=C3 |
| InChI | 1S/C15H11ClO2/c16-12-7-5-10(6-8-12)15(17)14-9-11-3-1-2-4-13(11)18-14/h1-9,15,17H |
| InChIKey | KBFBRIPYVVGWRS-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.528°C at 760 mmHg (Cal.) |
| Flash point | 202.08°C (Cal.) |
| Market Analysis Reports |