| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 5-Ethyl-5-(bicyclo(3.2.1)octenyl)barbituric acid |
|---|---|
| Synonyms | 5-(3-Bicyclo[3.2.1]Oct-3-Enyl)-5-Ethyl-Hexahydropyrimidine-2,4,6-Trione; 5-(3-Bicyclo[3.2.1]Oct-3-Enyl)-5-Ethylhexahydropyrimidine-2,4,6-Trione; 5-(3-Bicyclo[3.2.1]Oct-3-Enyl)-5-Ethyl-Barbituric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 |
| CAS Registry Number | 3625-25-0 |
| SMILES | C(C3(C1=CC2CC(C1)CC2)C(=O)NC(=O)NC3=O)C |
| InChI | 1S/C14H18N2O3/c1-2-14(11(17)15-13(19)16-12(14)18)10-6-8-3-4-9(5-8)7-10/h6,8-9H,2-5,7H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | MKELYWOVSPVORM-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |