| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Norpseudoephedrine |
|---|---|
| Synonyms | (1R,2R)-2-Amino-1-Phenyl-Propan-1-Ol; Benzenemethanol, Alpha-(1-Aminoethyl)-, (R*,R*)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 |
| CAS Registry Number | 36393-56-3 |
| EINECS | 253-014-6 |
| SMILES | [C@@H](O)(C1=CC=CC=C1)[C@H](N)C |
| InChI | 1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m1/s1 |
| InChIKey | DLNKOYKMWOXYQA-APPZFPTMSA-N |
| Density | 1.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.143°C at 760 mmHg (Cal.) |
| Flash point | 128.065°C (Cal.) |
| (1) | Alan C. Spivey, Matthew Weston and Steven Woodhead. Celastraceae sesquiterpenoids: biological activity and synthesis, Chem. Soc. Rev., 2002, 31, 43. |
|---|---|
| Market Analysis Reports |