| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | N',N',3-Trimethylphenazine-2,8-Diamine |
|---|---|
| Synonyms | (8-Amino-7-Methyl-Phenazin-2-Yl)-Dimethyl-Amine; N(Sup 8),N(Sup 8),3-Trimethyl-2,8-Phenazinediamine; Neutral Red Base |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 |
| CAS Registry Number | 366-13-2 |
| SMILES | C1=C3C(=CC=C1N(C)C)N=C2C=C(C)C(=CC2=N3)N |
| InChI | 1S/C15H16N4/c1-9-6-13-15(8-11(9)16)18-14-7-10(19(2)3)4-5-12(14)17-13/h4-8H,16H2,1-3H3 |
| InChIKey | GLVRJEJEXGVOMJ-UHFFFAOYSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.337°C at 760 mmHg (Cal.) |
| Flash point | 254.58°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Isaacs Lyle. Cucurbit[n]urils: from mechanism to structure and function, Chemical Communications, 2009 |
|---|---|
| Market Analysis Reports |