|
CAS#: 36792-88-8 Product: 2-Deoxy-beta-D-Erythro-Pentofuranose No suppilers available for the product. |
| Name | 2-Deoxy-beta-D-Erythro-Pentofuranose |
|---|---|
| Synonyms | 2-Deoxy-β-d-ribofuranose; 2-Deoxy-β-L-erythro-pentofuranose; C01801 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 |
| CAS Registry Number | 36792-88-8 |
| SMILES | C1[C@@H]([C@H](O[C@H]1O)CO)O |
| InChI | 1S/C5H10O4/c6-2-4-3(7)1-5(8)9-4/h3-8H,1-2H2/t3-,4+,5+/m0/s1 |
| InChIKey | PDWIQYODPROSQH-VPENINKCSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 173.3±27.9°C (Cal.) |
| (1) | Maurizio Guerra. Anomalous phase shift between the angular dependence of the 5'-H hfs constants produced by the phosphate groups in C4' deoxyribose radicals: an electronic rather than a structural effect, Phys. Chem. Chem. Phys., 2001, 3, 3792. |
|---|---|
| Market Analysis Reports |