| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Georganics Ltd. | Slovakia | |||
|---|---|---|---|---|
![]() |
+421 (33) 640-3132 | |||
![]() |
georganics@nextra.sk | |||
| Chemical manufacturer since 1998 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 4-N-Pentyloxybenzoyl Chloride |
|---|---|
| Synonyms | 4-Amoxybenzoyl Chloride; Nsc 7951 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 |
| CAS Registry Number | 36823-84-4 |
| EINECS | 253-230-0 |
| SMILES | C1=C(C=CC(=C1)C(=O)Cl)OCCCCC |
| InChI | 1S/C12H15ClO2/c1-2-3-4-9-15-11-7-5-10(6-8-11)12(13)14/h5-8H,2-4,9H2,1H3 |
| InChIKey | IBQDPNHVFRFCFK-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| 1.087 (Expl.) | |
| Boiling point | 198-200°C (Expl.) |
| 324.5±15.0°C at 760 mmHg (Cal.) | |
| Flash point | 120.5±20.8°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.543 (Expl.) |
| Safety Code | S20;S23;S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3265 |
| Safety Description | DANGER: CORROSIVE, Water reactive, burns skin and eyes. |
| DANGER: CORROSIVE, burns skin and eyes | |
| SDS | Available |
| Market Analysis Reports |