| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Iodoquinoxaline |
|---|---|
| Synonyms | InChI=1/C8H5IN2/c9-8-5-10-6-3-1-2-4-7(6)11-8/h1-5H |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5IN2 |
| Molecular Weight | 256.04 |
| CAS Registry Number | 36856-92-5 |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)I |
| InChI | 1S/C8H5IN2/c9-8-5-10-6-3-1-2-4-7(6)11-8/h1-5H |
| InChIKey | MVOAJLXOFBNEIM-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.1±22.0°C at 760 mmHg (Cal.) |
| Flash point | 150.4±22.3°C (Cal.) |
| (1) | Montserrat Armengol and John A. Joule. Synthesis of thieno[2,3-b]quinoxalines from 2-haloquinoxalines, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 154. |
|---|---|
| Market Analysis Reports |