| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | N,N-Dimethyladamantan-1-Amine |
|---|---|
| Synonyms | N,N-Dimethyl-1-Adamantanamine; 1-Adamantyl-Dimethyl-Amine; N,N-Dimethyltricyclo(3.3.1.1(Sup 3,7))Decan-1-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.30 |
| CAS Registry Number | 3717-40-6 |
| SMILES | CN(C)C12CC3CC(C1)CC(C2)C3 |
| InChI | 1S/C12H21N/c1-13(2)12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,3-8H2,1-2H3 |
| InChIKey | NFBYCNFAXLUGBT-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.283°C at 760 mmHg (Cal.) |
| Flash point | 88.175°C (Cal.) |
| (1) | Pol Besenius, Peter A. G. Cormack, R. Frederick Ludlow, Sijbren Otto and David C. Sherrington. Affinity chromatography in dynamic combinatorial libraries: one-pot amplification and isolation of a strongly binding receptor, Org. Biomol. Chem., 2010, 8, 2414. |
|---|---|
| Market Analysis Reports |