| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 1,2,3,4-Cyclopentanetetracarboxylic Acid |
|---|---|
| Synonyms | 1,2,3,4-Tetracarboxycyclopentane; Oprea1_132715 |
| Molecular Formula | C9H10O8 |
| Molecular Weight | 246.17 |
| CAS Registry Number | 3724-52-5 |
| EINECS | 223-074-8 |
| SMILES | O=C(C1C(C(C(O)=O)CC1C(O)=O)C(O)=O)O |
| InChI | 1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | WOSVXXBNNCUXMT-UHFFFAOYSA-N |
| Density | 1.788g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.598°C at 760 mmHg (Cal.) |
| Flash point | 267.626°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ru-Xin Yao, Zheng-Ming Hao, Cai-Hong Guo and Xian-Ming Zhang. Enantiomers of conformation-flexible cyclopentane-1,2,3,4-tetracarboxylate in metal–organic frameworks, CrystEngComm, 2010, 12, 4416. |
|---|---|
| Market Analysis Reports |