|
CAS#: 37370-41-5 Product: D-Glucose, mixt. with D-fructose No suppilers available for the product. |
| Name | D-Glucose, mixt. with D-fructose |
|---|---|
| Synonyms | Sweetrex; D-Glucose, Mixt. With D-Fructose |
| Molecular Structure | ![]() |
| Molecular Formula | C12H24O12 |
| Molecular Weight | 360.31 |
| CAS Registry Number | 37370-41-5 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)CO)C(=O)CO.[C@H](O)([C@H](O)[C@@H](O)C=O)[C@H](O)CO |
| InChI | 1S/2C6H12O6/c2*7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2;1,3-6,8-12H,2H2/t3-,5-,6-;3-,4+,5+,6+/m10/s1 |
| InChIKey | PJVXUVWGSCCGHT-ZPYZYFCMSA-N |
| Boiling point | 551.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 301.5°C (Cal.) |
| Market Analysis Reports |