| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bedoukian Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 830-4000 | |||
![]() |
customerservice@bedoukian.com | |||
| Chemical manufacturer since 1972 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aromatic carboxylic acid ester |
|---|---|
| Name | Benzyl Tiglate |
| Synonyms | Phenylmethyl 2-Methylbut-2-Enoate; (E)-2-Methylbut-2-Enoic Acid Phenylmethyl Ester; 2-Methylbut-2-Enoic Acid Phenylmethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 37526-88-8 |
| EINECS | 253-544-8 |
| FEMA | 3330 |
| SMILES | C1=C(C=CC=C1)COC(C(=C/C)/C)=O |
| InChI | 1S/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
| InChIKey | QRGSTISKDZCDHV-XCVCLJGOSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 1.033 (Expl.) | |
| Boiling point | 267.7±9.0°C at 760 mmHg (Cal.) |
| 250°C (Expl.) | |
| Flash point | 135.9±9.9°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.52 (Expl.) |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates lungs, eyes, skin |
| SDS | Available |
| Market Analysis Reports |