| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Ethyleneglycol biscarboxyphenyl ether |
|---|---|
| Synonyms | 4,4'-(1,2-Ethanediylbis(Oxy))Bisbenzoic Acid; Benzoic Acid, 4,4'-(1,2-Ethanediylbis(Oxy))Bis- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 |
| CAS Registry Number | 3753-05-7 |
| EINECS | 223-155-8 |
| SMILES | C1=CC(=CC=C1C(O)=O)OCCOC2=CC=C(C(O)=O)C=C2 |
| InChI | 1S/C16H14O6/c17-15(18)11-1-5-13(6-2-11)21-9-10-22-14-7-3-12(4-8-14)16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | VAXBLYWAVAIJJJ-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.223°C at 760 mmHg (Cal.) |
| Flash point | 205.324°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jian-Qiang Liu, Yao-Yu Wang and Yun-Sheng Huang. Structural variability of Co(ii) and Ni(ii) entangled metal–organic frameworks: effect of N-donor ligands and metal ions, CrystEngComm, 2011, 13, 3733. |
|---|---|
| Market Analysis Reports |