| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives |
|---|---|
| Name | Erucic Acid Ethyl Ester |
| Synonyms | (Z)-Docos-13-Enoic Acid Ethyl Ester; Erucic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C24H46O2 |
| Molecular Weight | 366.63 |
| CAS Registry Number | 37910-77-3 |
| EINECS | 253-712-0 |
| SMILES | C(CCCCCCCC\C=C/CCCCCCCC)CCC(OCC)=O |
| InChI | 1S/C24H46O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26-4-2/h11-12H,3-10,13-23H2,1-2H3/b12-11- |
| InChIKey | WFZQLUSOXHIVKL-QXMHVHEDSA-N |
| Density | 0.869g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.771°C at 760 mmHg (Cal.) |
| Flash point | 82.926°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |