| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Tolamolol |
|---|---|
| Synonyms | Tolamolol; Tolamolol [Usan:Ban:Inn]; Tolamololum [Inn-Latin] |
| Molecular Structure | ![]() |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 |
| CAS Registry Number | 38103-61-6 |
| EINECS | 253-783-8 |
| SMILES | C1=CC=CC(=C1OCC(CNCCOC2=CC=C(C=C2)C(N)=O)O)C |
| InChI | 1S/C19H24N2O4/c1-14-4-2-3-5-18(14)25-13-16(22)12-21-10-11-24-17-8-6-15(7-9-17)19(20)23/h2-9,16,21-22H,10-13H2,1H3,(H2,20,23) |
| InChIKey | SKQDKFOTIPJUSV-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 595.204°C at 760 mmHg (Cal.) |
| Flash point | 313.768°C (Cal.) |
| (1) | Franco Lombardo, R. Scott Obach, Marina Y. Shalaeva, and Feng Gao. Prediction of Human Volume of Distribution Values for Neutral and Basic Drugs. 2. Extended Data Set and Leave-Class-Out Statistics, J. Med. Chem., 2004, 47(5), 1242-1250 |
|---|---|
| Market Analysis Reports |