| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 4,5-Dimethoxy-2-(methylsulfinyl)toluene |
|---|---|
| Synonyms | 1,2-Dimethoxy-4-Methyl-5-Methylsulfinyl-Benzene; Nsc321277; Rx-71107 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.28 |
| CAS Registry Number | 38452-29-8 |
| SMILES | C1=C(OC)C(=CC(=C1[S](C)=O)C)OC |
| InChI | 1S/C10H14O3S/c1-7-5-8(12-2)9(13-3)6-10(7)14(4)11/h5-6H,1-4H3 |
| InChIKey | OZNTVIXYGTUPJY-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.014°C at 760 mmHg (Cal.) |
| Flash point | 173.95°C (Cal.) |
| (1) | Zhao YH, Abraham MH, Le J, Hersey A, Luscombe CN, Beck G, Sherborne B, and Cooper I. Rate-limited Steps of Human Oral Absorption and QSAR Studies, Pharm Res., 2002, 19(10), 1446-57 |
|---|---|
| Market Analysis Reports |