| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aliphatic carboxylate |
|---|---|
| Name | Isobutyl Gallate |
| Synonyms | Isobutyl 3,4,5-Trihydroxybenzoate; 3,4,5-Trihydroxybenzoic Acid Isobutyl Ester; Nsc147482 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 3856-05-1 |
| EINECS | 223-363-9 |
| SMILES | C1=C(C(=C(C=C1C(OCC(C)C)=O)O)O)O |
| InChI | 1S/C11H14O5/c1-6(2)5-16-11(15)7-3-8(12)10(14)9(13)4-7/h3-4,6,12-14H,5H2,1-2H3 |
| InChIKey | UCLHVCFKZSLALE-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Melting point | 132°C (Expl.) |
| Boiling point | 444.321°C at 760 mmHg (Cal.) |
| Flash point | 175.402°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |