|
CAS#: 38809-73-3 Product: 1-Vinyl-2-pyrrolidinone polymer with methyl methacrylate and allyl methacrylate No suppilers available for the product. |
| Name | 1-Vinyl-2-pyrrolidinone polymer with methyl methacrylate and allyl methacrylate |
|---|---|
| Synonyms | Allyl 2-Methylprop-2-Enoate; Methyl 2-Methylprop-2-Enoate; 1-Vinylpyrrolidin-2-One; 2-Methylprop-2-Enoic Acid Allyl Ester; 2-Methylprop-2-Enoic Acid Methyl Ester; 1-Vinyl-2-Pyrrolidinone |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 |
| CAS Registry Number | 38809-73-3 |
| SMILES | O=C1N(CCC1)C=C.C(OC(=O)C(=C)C)C=C.CC(C(OC)=O)=C |
| InChI | 1S/C7H10O2.C6H9NO.C5H8O2/c1-4-5-9-7(8)6(2)3;1-2-7-5-3-4-6(7)8;1-4(2)5(6)7-3/h4H,1-2,5H2,3H3;2H,1,3-5H2;1H2,2-3H3 |
| InChIKey | HVYQZCLEPABLCN-UHFFFAOYSA-N |
| Boiling point | 138.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 33.9°C (Cal.) |
| Market Analysis Reports |