| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Oakwood Products, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 467-3386 | |||
![]() |
k_weaver@oakwoodchemical.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Hydrocarbon halide |
|---|---|
| Name | 4H,4'H-Octafluorobiphenyl |
| Synonyms | 4,4'-Dihydrooctafluorobiphenyl; 4-H, 4'-H-Octafluorobiphenyl; 4H,4'H-Octafluorobiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H2F8 |
| Molecular Weight | 298.14 |
| CAS Registry Number | 3883-86-1 |
| EINECS | 223-418-7 |
| SMILES | C2=C(C(=C(C1=C(C(=CC(=C1F)F)F)F)C(=C2F)F)F)F |
| InChI | 1S/C12H2F8/c13-3-1-4(14)10(18)7(9(3)17)8-11(19)5(15)2-6(16)12(8)20/h1-2H |
| InChIKey | QWCHHUZAAGRHDB-UHFFFAOYSA-N |
| Density | 1.582g/cm3 (Cal.) |
|---|---|
| Melting point | 85°C (Expl.) |
| Boiling point | 222.424°C at 760 mmHg (Cal.) |
| Flash point | 73.902°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |