Online Database of Chemicals from Around the World

Corey PG-lactone diol
[CAS 39182-59-7]

List of Suppliers
Shenyang OllyChem Technology Co., Ltd. China
www.ollychem.com
+86 (24) 6225-9849
+86 13840042106
+86 (24) 6225-9831
info@ollychem.com
oliverdu@ollychem.com
Chemical manufacturer since 2001
chemBlink Standard supplier since 2007

Identification
ClassificationAPI >> Hormone and endocrine-regulating drugs >> Prostaglandins
NameCorey PG-lactone diol
Synonyms5-hydroxy-4-[(E)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one
Molecular StructureCorey PG-lactone diol molecular structure (CAS 39182-59-7)
Molecular FormulaC15H24O4
Molecular Weight268.35
CAS Registry Number39182-59-7
SMILESCCCCCC(/C=C/C1C(CC2C1CC(=O)O2)O)O
Safety Data
SDSAvailable
up Discovery and Applications
Corey PG-lactone diol is a significant chemical compound that has attracted attention in the fields of organic synthesis and medicinal chemistry due to its unique structural features and potential therapeutic applications. The discovery of Corey PG-lactone diol can be traced back to the advancements in lactone chemistry, particularly the interest in compounds that can serve as versatile intermediates in organic synthesis.

The synthesis of Corey PG-lactone diol typically involves the selective functionalization of lactones, which are cyclic esters known for their stability and reactivity. This compound is characterized by a bicyclic structure that provides a framework for further derivatization. The discovery process for Corey PG-lactone diol has included various synthetic strategies, including the use of stereoselective reactions that yield high enantiomeric purity.

Corey PG-lactone diol has several applications, particularly in medicinal chemistry. One of its notable uses is as a precursor for the synthesis of bioactive molecules, including potential pharmaceuticals that target various biological pathways. The compound's structure allows for modifications that can enhance biological activity, making it a valuable building block in drug design. Additionally, the presence of hydroxyl groups in the diol can facilitate further chemical transformations, increasing its utility in organic synthesis.

In the pharmaceutical industry, Corey PG-lactone diol has garnered interest for its potential in developing compounds that can act as anti-inflammatory agents or serve in cancer therapy. Researchers are exploring its biological properties to identify specific therapeutic targets and pathways it may influence. The compound's ability to undergo further transformations means it can be tailored to meet the specific needs of drug development, enhancing its prospects as a therapeutic agent.

Moreover, Corey PG-lactone diol's applications extend beyond medicinal chemistry. It is also explored in materials science for the development of biodegradable polymers, which can contribute to sustainable practices in various industries. The compound's structural properties lend themselves to the creation of materials with desirable mechanical and chemical characteristics.

In summary, Corey PG-lactone diol is a noteworthy compound in the realms of organic synthesis and medicinal chemistry, with its unique structural features enabling diverse applications. Ongoing research into its properties and potential applications continues to shed light on its significance as a versatile intermediate and therapeutic candidate in drug discovery.

References

none
Market Analysis Reports
Related Products
CORDIERITE  Cordycepin  (-)-Corey aldeh...  Corey lactone  (-)-Corey lacto...  (-)-Corey lacto...  (+/-)-Corey lac...  (+)-Corey lacto...  (+/-)-Corey lac...  (-)-Corey lacto...  (+)-Coriamyrtin  Coriander Extra...  Coriander Oil  Corianin  Coriaria Lacton...  Coriatin  Corilagin  Coriphosphine  Coriphosphine O  (+)-Corlumidine