| Advanced Synthesis | USA | |||
|---|---|---|---|---|
![]() |
+1 (619) 423-7821 | |||
![]() |
sales@advancedsynthesis.com | |||
| Chemical manufacturer | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Chemical reagent >> Organic reagent >> Acid halide |
|---|---|
| Name | 4-n-Hexyloxybenzoyl Chloride |
| Synonyms | Zinc02140815; 222119_Aldrich; 4-(Hexyloxy)Benzoyl Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 |
| CAS Registry Number | 39649-71-3 |
| EINECS | 254-561-3 |
| SMILES | C1=C(C=CC(=C1)C(=O)Cl)OCCCCCC |
| InChI | 1S/C13H17ClO2/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15/h6-9H,2-5,10H2,1H3 |
| InChIKey | DQQOONVCLQZWOY-UHFFFAOYSA-N |
| Density | 1.082 (Expl.) |
|---|---|
| 1.1±0.1g/cm3 (Cal.) | |
| Boiling point | 332.494°C at 760 mmHg (Cal.) |
| 203-205°C (Expl.) | |
| Flash point | 125.8±20.8°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.5383 (Expl.) |
| Safety Code | S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN3265 |
| Safety Description | DANGER: CORROSIVE, Water reactive, burns skin and eyes. |
| DANGER: CORROSIVE, burns skin and eyes | |
| SDS | Available |
| Market Analysis Reports |