| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| BoroChem | France | |||
|---|---|---|---|---|
![]() |
+33 (2) 3194-5073 | |||
![]() |
info@borochem.fr | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 5-Nitro-1,2-Benzisoxazole |
|---|---|
| Synonyms | 5-Nitroindoxazene; 5-Nitrobenzisoxazole |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.12 |
| CAS Registry Number | 39835-28-4 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1C=NO2 |
| InChI | 1S/C7H4N2O3/c10-9(11)6-1-2-7-5(3-6)4-8-12-7/h1-4H |
| InChIKey | TWOYWCWKYDYTIP-UHFFFAOYSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.734°C at 760 mmHg (Cal.) |
| Flash point | 148.38°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jaap E. Klijn and Jan B. F. N. Engberts. The Kemp elimination in membrane mimetic reaction media. Probing catalytic properties of cationic vesicles formed from a double-tailed amphiphile and linear long-tailed alcohols or alkyl pyranosides, Org. Biomol. Chem., 2004, 2, 1789. |
|---|---|
| Market Analysis Reports |