| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Trylead Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8708-6220 | |||
![]() |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 4-Decyloxyaniline |
|---|---|
| Synonyms | (4-Decoxyphenyl)Amine; M & B 2655; P-(Decyloxy)Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 |
| CAS Registry Number | 39905-47-0 |
| SMILES | C1=CC(=CC=C1OCCCCCCCCCC)N |
| InChI | 1S/C16H27NO/c1-2-3-4-5-6-7-8-9-14-18-16-12-10-15(17)11-13-16/h10-13H,2-9,14,17H2,1H3 |
| InChIKey | XWGJQNKDSHYJID-UHFFFAOYSA-N |
| Density | 0.944g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.313°C at 760 mmHg (Cal.) |
| Flash point | 166.319°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ganna Podoprygorina, Michael Bolte and Volker Böhmer. Tetra-urea calix[4]arenes 1,3-bridged at the narrow rim, Org. Biomol. Chem., 2009, 7, 1592. |
|---|---|
| Market Analysis Reports |