| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 1(Or 3)-Nitro-9H-Carbazole |
|---|---|
| Synonyms | Zinc02022154; Nciopen2_005191; Stock1s-66094 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 |
| CAS Registry Number | 39925-48-9 |
| SMILES | C1=CC=C2C(=C1[N+]([O-])=O)[NH]C3=CC=CC=C23 |
| InChI | 1S/C12H8N2O2/c15-14(16)11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,13H |
| InChIKey | VYOKOQDVBBWPKO-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.591°C at 760 mmHg (Cal.) |
| Flash point | 225.1°C (Cal.) |
| (1) | Mariana Mesaros, Sergio M. Bonesi, Maria A. Ponce, Rosa Erra-Balsells and Gabriel M. Bilmes. The photophysics of nitrocarbazoles studied by using spectroscopic, photoacoustic and luminescence techniques, Photochem. Photobiol. Sci., 2003, 2, 808. |
|---|---|
| Market Analysis Reports |