| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Sequoia Research Products Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (7802) 291-086 | |||
![]() |
info@seqchem.com | |||
| Chemical distributor | ||||
| Name | 20-Methoxy-4,8,13,17-Tetramethyl-20-Oxoicosa-2,4,6,8,10,12,14,16,18-Nonaenoic Acid |
|---|---|
| Synonyms | (2E,4E,6E,8E,10E,12E,14E,16E,18E)-20-Methoxy-4,8,13,17-Tetramethyl-20-Oxoicosa-2,4,6,8,10,12,14,16,18-Nonaenoic Acid; (2E,4E,6E,8E,10E,12E,14E,16E,18E)-20-Methoxy-4,8,13,17-Tetramethyl-20-Oxo-Icosa-2,4,6,8,10,12,14,16,18-Nonaenoic Acid; 20-Methoxy-4,8,13,17-Tetramethyl-20-Oxo-Icosa-2,4,6,8,10,12,14,16,18-Nonaenoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 |
| CAS Registry Number | 39937-23-0 |
| SMILES | CC(/C=C/C(OC)=O)=C\C=C\C(=C\C=C\C=C(\C=C\C=C(\C=C\C(O)=O)C)C)C |
| InChI | 1S/C25H30O4/c1-20(12-8-14-22(3)16-18-24(26)27)10-6-7-11-21(2)13-9-15-23(4)17-19-25(28)29-5/h6-19H,1-5H3,(H,26,27)/b7-6+,12-8+,13-9+,18-16+,19-17+,20-10+,21-11+,22-14+,23-15+ |
| InChIKey | RAFGELQLHMBRHD-IFNPSABLSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 596.0±23.0°C at 760 mmHg (Cal.) |
| Flash point | 197.8±16.1°C (Cal.) |
| (1) | Lili Wang, Hongguo Liu and Jingcheng Hao. Stable porphyrin vesicles formed in non-aqueous media and dried to produce hollow shells, Chem. Commun., 2009, 1353. |
|---|---|
| Market Analysis Reports |