|
CAS#: 39979-46-9 Product: 1-[6-(2,5-Dioxopyrrol-1-Yl)-2,2,4-Trimethylhexyl]Pyrrole-2,5-Dione No suppilers available for the product. |
| Name | 1-[6-(2,5-Dioxopyrrol-1-Yl)-2,2,4-Trimethylhexyl]Pyrrole-2,5-Dione |
|---|---|
| Synonyms | 1-[6-(2,5-Dioxopyrrol-1-Yl)-2,2,4-Trimethyl-Hexyl]Pyrrole-2,5-Dione; 1-[6-(2,5-Dioxo-1-Pyrrolyl)-2,2,4-Trimethylhexyl]Pyrrole-2,5-Dione; 1-(6-Maleimido-2,2,4-Trimethyl-Hexyl)-3-Pyrroline-2,5-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 |
| CAS Registry Number | 39979-46-9 |
| EINECS | 254-730-1 |
| SMILES | C(N1C(=O)C=CC1=O)CC(C)CC(CN2C(=O)C=CC2=O)(C)C |
| InChI | 1S/C17H22N2O4/c1-12(8-9-18-13(20)4-5-14(18)21)10-17(2,3)11-19-15(22)6-7-16(19)23/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | XQCDLHVXAXBMGW-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.532°C at 760 mmHg (Cal.) |
| Flash point | 208.21°C (Cal.) |
| (1) | Zhi Wang, Qichao Ran, Rongqi Zhu and Yi Gu. A novel benzoxazine/bismaleimide blend resulting in bi-continuous phase separated morphology, RSC Advances, 2013, 3, 1350. |
|---|---|
| Market Analysis Reports |