| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Aroz Technologies, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (877) 818-2125 | |||
![]() |
sales@aroztech.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 3-(1H-Benzimidazol-2-Yl)-Benzoic Acid |
|---|---|
| Synonyms | Zinc00196419 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9N2O2 |
| Molecular Weight | 237.24 |
| CAS Registry Number | 402944-81-4 |
| SMILES | C1=CC2=C(C=C1)N=C([NH]2)C3=CC(=CC=C3)C(=O)[O-] |
| InChI | 1S/C14H10N2O2/c17-14(18)10-5-3-4-9(8-10)13-15-11-6-1-2-7-12(11)16-13/h1-8H,(H,15,16)(H,17,18)/p-1 |
| InChIKey | BQKXFNQLZLSSEP-UHFFFAOYSA-M |
| Boiling point | 530.382°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 274.565°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Chen, Y and Shoichet BK. Molecular docking and ligand specificity in fragment-based inhibitor design, Nature Chemical Biology, 2009 |
|---|---|
| Market Analysis Reports |