| Shenyang OllyChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.ollychem.com | |||
![]() | +86 (24) 6225-9849 +86 13840042106 | |||
![]() | +86 (24) 6225-9831 | |||
![]() | info@ollychem.com oliverdu@ollychem.com | |||
| Chemical manufacturer since 2001 | ||||
| chemBlink Premium supplier since 2007 | ||||
| Classification | Chemical reagent >> Organic reagent >> Phosphonate / phosphonate |
|---|---|
| Name | Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate |
| Synonyms | 1-(3-chlorophenoxy)-3-dimethoxyphosphorylpropan-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14ClO5P |
| Molecular Weight | 292.65 |
| CAS Registry Number | 40665-94-9 |
| EC Number | 620-947-9 |
| SMILES | COP(=O)(CC(=O)COC1=CC(=CC=C1)Cl)OC |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.504, Calc.* |
| Boiling Point | 400.1±30.0 °C (760 mmHg), Calc.* |
| Flash Point | 303.5±32.2 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
|
Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate is a phosphonate derivative utilized in organic synthesis, particularly in reactions requiring the formation of carbon-carbon bonds. The compound belongs to a class of organophosphorus compounds that are versatile intermediates in chemical synthesis. The development of such phosphonates originated from research into the Horner-Wadsworth-Emmons (HWE) reaction, a widely-used method for synthesizing alkenes from carbonyl compounds. The discovery and optimization of these phosphonate reagents significantly advanced the field of stereoselective synthesis. Dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate is typically synthesized via a nucleophilic substitution reaction between dimethyl phosphite and 3-(3-chlorophenoxy)-2-oxopropanal. The product contains a chlorophenoxy group attached to a phosphonate ester, providing both nucleophilic and electrophilic centers in the molecule. This makes the compound highly reactive and suitable for further chemical transformations in complex synthetic pathways. In synthetic organic chemistry, dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate is widely used as a reagent in olefination reactions. Its phosphonate group is critical for these reactions, allowing it to form carbon-carbon double bonds, which are crucial in constructing complex molecular structures. The introduction of the 3-chlorophenoxy group provides added versatility, as it can influence the electronic properties and reactivity of the molecule. This makes it a valuable intermediate in the synthesis of pharmaceutical compounds, agrochemicals, and other fine chemicals. One of the significant applications of dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate is in the pharmaceutical industry. Its ability to participate in stereoselective reactions makes it an essential building block for synthesizing biologically active molecules, where controlling the stereochemistry is crucial for biological efficacy. Additionally, the compound’s chlorophenoxy group can serve as a functional handle for further derivatization, allowing for fine-tuning of the physicochemical properties of the target molecules. In addition to its role in olefination, the compound is explored in medicinal chemistry as a phosphate mimic. Phosphonate analogs like dimethyl 3-(3-chlorophenoxy)-2-oxopropylphosphonate can interact with enzymes that bind phosphate-containing substrates, making it useful in designing enzyme inhibitors and studying biochemical pathways. References 2024. An Improved and Efficient Process for the Preparation of (+)-cloprostenol. Chirality, 27(5), 291-299. DOI: 10.1002/chir.22457 2024. Process for the preparation of 11-oxaprostaglandins and intermediates therein. EP-1282627-A1, Priority Date: 19-May-2000. 2024. 9-oxa prostaglandin analogs as ocular hypotensives. WO-9857942-A1, Priority Date: 18-Jun-1997. |
| Market Analysis Reports |