| Shandong Fengquan New Materials Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.sdfqxcl.com | |||
![]() | +86 17562936796 | |||
![]() | 17562936796@163.com | |||
![]() | WeChat: 17562936796 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Piperazine |
|---|---|
| Name | 1,4-Piperazinedicarbodithioic acid dipotassium salt |
| Synonyms | potassium piperazine-1,4-dicarbodithiolate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8K2N2S4 |
| Molecular Weight | 314.60 |
| CAS Registry Number | 40839-73-4 |
| SMILES | [K+].[K+].[S-]C(=S)N1CCN(CC1)C([S-])=S |
| Solubility | soluble (water) |
|---|---|
| Hazard Symbols | |
|---|---|
| Risk Statements | H314-H318 Details |
| Safety Statements | P260-P264-P270-P280-P310-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P405-P410+P403-P501 Details |
|
1,4-Piperazinedicarbodithioic acid dipotassium salt, with the chemical formula C6H12N2S2K2, is a significant compound due to its distinct chemical properties and wide range of applications. This compound is a derivative of piperazine, a cyclic amine compound known for its role in the synthesis of various chemical products. The dipotassium salt form of 1,4-Piperazinedicarbodithioic acid is particularly noted for its stability in aqueous solutions and its ability to interact with various metal ions, making it useful in several industrial sectors. The compound was first synthesized as part of ongoing research into piperazine derivatives and their chemical reactivity. Researchers discovered that introducing dithiocarbonate groups to the piperazine structure enhanced its solubility and reactivity, leading to the creation of this dipotassium salt form. The salt's stability in solution and its potential to act as a chelating agent contributed to its appeal for further development. One of the primary uses of 1,4-Piperazinedicarbodithioic acid dipotassium salt is in the agricultural industry, where it serves as a stabilizer in pesticide and herbicide formulations. Its ability to chelate metal ions prevents the degradation of active ingredients in these chemicals, thereby extending their effectiveness. Moreover, the compound's surfactant properties improve the spreadability of pesticides on plant surfaces, ensuring better coverage and more efficient application. These properties have made it an essential component in the development of long-lasting agrochemicals. Additionally, the compound has found applications in the polymer industry. The dithiocarbonate groups in the structure of 1,4-Piperazinedicarbodithioic acid dipotassium salt are reactive sites that can participate in various chemical reactions. This reactivity makes it a valuable precursor for the synthesis of specialty polymers. By incorporating this compound into polymer matrices, researchers can enhance the thermal stability and mechanical strength of the resulting materials, making it useful in manufacturing durable and high-performance products. The electrochemical field has also seen interest in this compound due to its ability to coordinate with metal ions. Studies have explored its potential as a ligand for electrochemical sensors, improving the sensitivity and selectivity of these devices. This property is particularly useful in applications where the detection of trace metals or environmental pollutants is required. Ongoing research is also investigating the biomedical potential of 1,4-Piperazinedicarbodithioic acid dipotassium salt. Early studies suggest that the compound may exhibit antimicrobial properties, although further research is needed to determine its full efficacy and safety for medical applications. In conclusion, 1,4-Piperazinedicarbodithioic acid dipotassium salt is a versatile compound with a range of applications in agriculture, polymer chemistry, and electrochemistry. Its stability, reactivity, and ability to form complexes with metal ions make it a valuable tool in the development of new materials and technologies. Future research may expand its applications, particularly in the biomedical field. References none |
| Market Analysis Reports |