|
CAS#: 4163-15-9 Product: 17-(Cyclopropylmethyl)Morphinan-3-Ol No suppilers available for the product. |
| Name | 17-(Cyclopropylmethyl)Morphinan-3-Ol |
|---|---|
| Synonyms | 17-(Cyclopropylmethyl)Morphinan-3-Ol; Cyclorphan |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 |
| CAS Registry Number | 4163-15-9 |
| EINECS | 224-007-5 |
| SMILES | [C@]235[C@H]([C@H](N(CC1CC1)CC2)CC4=C3C=C(O)C=C4)CCCC5 |
| InChI | 1S/C20H27NO/c22-16-7-6-15-11-19-17-3-1-2-8-20(17,18(15)12-16)9-10-21(19)13-14-4-5-14/h6-7,12,14,17,19,22H,1-5,8-11,13H2/t17-,19+,20+/m0/s1 |
| InChIKey | NLBUEDSBXVNAPB-DFQSSKMNSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 232.5±27.4°C (Cal.) |
| (1) | Renner et al.. Bioactivity-Guided Mapping and Navigation of Chemical Space, Nature Chemical Biology, 2009 |
|---|---|
| Market Analysis Reports |