| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | Eupomatenoid 6 |
|---|---|
| Synonyms | 4-(3-Methyl-5-Prop-1-Enyl-1-Benzofuran-2-Yl)Phenol; 4-[3-Methyl-5-[(E)-Prop-1-Enyl]Benzofuran-2-Yl]Phenol; 4-(3-Methyl-5-Prop-1-Enyl-Benzofuran-2-Yl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 41744-26-7 |
| SMILES | C1=C(/C=C/C)C=CC2=C1C(=C(O2)C3=CC=C(C=C3)O)C |
| InChI | 1S/C18H16O2/c1-3-4-13-5-10-17-16(11-13)12(2)18(20-17)14-6-8-15(19)9-7-14/h3-11,19H,1-2H3/b4-3+ |
| InChIKey | KNFUWJAIDVAYOV-ONEGZZNKSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.883°C at 760 mmHg (Cal.) |
| Flash point | 208.948°C (Cal.) |
| (1) | Arnone A, Nasini G, Vajna De Pava O. Acid-catalysed dimerization of neolignans from Rathania. Assignment of epimeric configuration and conformation of the resulting indanofuran derivatives by 1H NMR spectroscopy, Gazzetta Chimica Italiana 1990, 120, 135-138 |
|---|---|
| Market Analysis Reports |