|
CAS#: 4176-06-1 Product: (+)-alpha-Curcumene No suppilers available for the product. |
| Name | (+)-alpha-Curcumene |
|---|---|
| Synonyms | 1-[(1S)-1,5-Dimethylhex-4-Enyl]-4-Methyl-Benzene; 1-[(1S)-1,5-Dimethylhex-4-Enyl]-4-Methylbenzene; Benzene, 1-[(1S)-1,5-Dimethyl-4-Hexenyl]-4-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 |
| CAS Registry Number | 4176-06-1 |
| SMILES | [C@@H](C1=CC=C(C=C1)C)(CCC=C(C)C)C |
| InChI | 1S/C15H22/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-11,14H,5,7H2,1-4H3/t14-/m0/s1 |
| InChIKey | VMYXUZSZMNBRCN-AWEZNQCLSA-N |
| Density | 0.873g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.32°C at 760 mmHg (Cal.) |
| Flash point | 117.206°C (Cal.) |
| (1) | Hisahiro Hagiwara, Tomoyuki Okabe, Hiroki Ono, Vijayendra P. KamatOn leave from Goa University, India., Takashi Hoshi, Toshio Suzuki and Masayoshi Ando. Total synthesis of bisabolane sesquiterpenoids, a-bisabol-1-one, curcumene, curcuphenol and elvirol: utility of catalytic enamine reaction in cyclohexenone synthesis, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 895. |
|---|---|
| Market Analysis Reports |