| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| RIA International LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Name | Carnidazole |
|---|---|
| Synonyms | O-Methyl [2-(2-Methyl-5-Nitro-Imidazol-1-Yl)Ethylamino]Methanethioate; [2-(2-Methyl-5-Nitro-1-Imidazolyl)Ethylamino]Methanethioic Acid O-Methyl Ester; [2-(2-Methyl-5-Nitro-Imidazol-1-Yl)Ethylamino]Methanethioic Acid O-Methyl Ester |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.27 |
| CAS Registry Number | 42116-76-7 |
| EINECS | 255-663-0 |
| SMILES | C1=C([N](C(=N1)C)CCNC(OC)=S)[N+](=O)[O-] |
| InChI | 1S/C8H12N4O3S/c1-6-10-5-7(12(13)14)11(6)4-3-9-8(16)15-2/h5H,3-4H2,1-2H3,(H,9,16) |
| InChIKey | OVEVHVURWWTPFC-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.8±51.0°C at 760 mmHg (Cal.) |
| Flash point | 209.5±30.4°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | G. Bernardinelli, T. Berclaz, M. Geoffroy and N. Rajalakshmi. Anhydrous Form of Carnidazole, C8H12N4O3S, Acta Cryst. (1995). C51, 1390-1392 |
|---|---|
| Market Analysis Reports |