| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Classification | Chemical reagent >> Silane reagent |
|---|---|
| Name | Aminotriphenylsilane |
| Synonyms | Tri(Phenyl)Silylamine; 376205_Aldrich |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17NSi |
| Molecular Weight | 275.43 |
| CAS Registry Number | 4215-80-9 |
| EINECS | 224-147-7 |
| SMILES | C1=C(C=CC=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)N |
| InChI | 1S/C18H17NSi/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,19H2 |
| InChIKey | GLQOALGKMKUSBF-UHFFFAOYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.531°C at 760 mmHg (Cal.) |
| Flash point | 175.472°C (Cal.) |
| (1) | Christian Lorber and Laure Vendier. Novel aspects of the transamination reaction between Ti(NMe) and primary amines, Dalton Trans., 2013, 42, 12203. |
|---|---|
| Market Analysis Reports |