| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | (E)9-(2-Phenylvinyl)Anthracene |
|---|---|
| Synonyms | 9-(2-Phenylethenyl)Anthracene; 9-[(E)-2-Phenylvinyl]Anthracene; 9-(2-Phenylvinyl)Anthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 42196-97-4 |
| EINECS | 255-705-8 |
| SMILES | C1=C4C(=C(C2=CC=CC=C12)\C=C\C3=CC=CC=C3)C=CC=C4 |
| InChI | 1S/C22H16/c1-2-8-17(9-3-1)14-15-22-20-12-6-4-10-18(20)16-19-11-5-7-13-21(19)22/h1-16H/b15-14+ |
| InChIKey | HCSGQHDONHRJCM-CCEZHUSRSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.405°C at 760 mmHg (Cal.) |
| Flash point | 236.501°C (Cal.) |
| (1) | Eun Ju Shin, Robert Stackow and Christopher S. Foote. Excited state properties of some 1-(9-anthryl)-2-naphthylethene and 1-(9-anthryl)-2-quinolylethene derivatives, Phys. Chem. Chem. Phys., 2002, 4, 5088. |
|---|---|
| Market Analysis Reports |