| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Name | 2,2-Diphenyl-2H-1-Benzopyran |
|---|---|
| Synonyms | 2H-1-Benzopyran, 2,2-Diphenyl-; Nsc115119; Oprea1_615184 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H16O |
| Molecular Weight | 284.36 |
| CAS Registry Number | 4222-08-6 |
| SMILES | C2=C1OC(C=CC1=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C21H16O/c1-3-10-18(11-4-1)21(19-12-5-2-6-13-19)16-15-17-9-7-8-14-20(17)22-21/h1-16H |
| InChIKey | IOZRRXQDBILMFX-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.373°C at 760 mmHg (Cal.) |
| Flash point | 212.329°C (Cal.) |
| (1) | Pier Luigi Gentili, Eugene Danilov, Fausto Ortica, Michael A. J. Rodgers and Gianna Favaro. Dynamics of the excited states of chromenes studied by fast and ultrafast spectroscopies, Photochem. Photobiol. Sci., 2004, 3, 886. |
|---|---|
| Market Analysis Reports |