|
CAS#: 4237-46-1 Product: 2-Hydroxy-1,2,2-Triphenylethanone No suppilers available for the product. |
| Name | 2-Hydroxy-1,2,2-Triphenylethanone |
|---|---|
| Synonyms | 2-Hydroxy-1,2,2-Triphenylethanone; Nsc4641; Benzoyldiphenylmethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O2 |
| Molecular Weight | 288.35 |
| CAS Registry Number | 4237-46-1 |
| SMILES | C1=CC=CC=C1C(C(O)(C2=CC=CC=C2)C3=CC=CC=C3)=O |
| InChI | 1S/C20H16O2/c21-19(16-10-4-1-5-11-16)20(22,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,22H |
| InChIKey | CKKQLOUBFINSIB-UHFFFAOYSA-N |
| Density | 1.186g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.778°C at 760 mmHg (Cal.) |
| Flash point | 198.148°C (Cal.) |
| (1) | Satoshi Hamatani, Kazuhide Tsuji, Akio Kawai and Kazuhiko Shibuya. Dispersed fluorescence spectra of jet-cooled benzophenone ketyl radical: Assignment of the low-frequency vibrational modes, Phys. Chem. Chem. Phys., 2003, 5, 1370. |
|---|---|
| Market Analysis Reports |