| Fenhe Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.fenhechem.com | |||
![]() | +86 (021) 3392-6068 | |||
![]() | julius.wei@fenhechem.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Anichem LLC | USA | |||
|---|---|---|---|---|
![]() | www.anichemllc.com | |||
![]() | +1 (732) 821-6500 | |||
![]() | +1 (732) 821-6008 | |||
![]() | sales@anichemllc.com | |||
| Chemical manufacturer | ||||
| Scientific Exchange, Inc. | USA | |||
|---|---|---|---|---|
![]() | www.htscompounds.com | |||
![]() | +1 (603) 539-7436 | |||
![]() | +1 (603) 539-7438 | |||
![]() | sales@htscompounds.com | |||
| Chemical distributor | ||||
| Innovapharm Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() | www.innovapharm.com.ua | |||
![]() | +38 (044) 559-9572 | |||
![]() | +38 (044) 482-7309 | |||
![]() | reag@nbi.com.ua | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() | www.uorsy.com | |||
![]() | +38 (044) 531-9497 | |||
![]() | +38 (044) 531-9497 | |||
![]() | sales.eu@uorsy.com sales.us@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Classification | API >> Synthetic anti-infective drugs >> Sulfonamides and synergists |
|---|---|
| Name | N-(tert-Butyl)-3-nitrobenzenesulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.29 |
| CAS Registry Number | 424818-25-7 |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(c1)[N+](=O)[O-] |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
|
N-(tert-Butyl)-3-nitrobenzenesulfonamide is a chemical compound with significant relevance in organic synthesis and pharmaceutical research. Characterized by the presence of a tert-butyl group attached to the nitrogen atom, a nitro group on the benzene ring, and a sulfonamide functional group, this compound exhibits unique chemical properties that make it valuable in various applications. The discovery of N-(tert-butyl)-3-nitrobenzenesulfonamide is rooted in the broader study of sulfonamides, a class of compounds historically significant for their role as antibiotics. While the classic sulfonamides, such as sulfanilamide, were first discovered in the early 20th century and revolutionized the treatment of bacterial infections, the development of derivatives like N-(tert-butyl)-3-nitrobenzenesulfonamide has expanded the utility of this chemical class beyond just antimicrobial applications. One of the key applications of N-(tert-butyl)-3-nitrobenzenesulfonamide is in organic synthesis, where it serves as an important intermediate in the preparation of more complex molecules. The compound’s structure, featuring a nitro group and a sulfonamide group, allows it to participate in a variety of chemical reactions. These include nucleophilic substitution reactions, where the nitro group activates the benzene ring, making it more susceptible to attack by nucleophiles. This reactivity is harnessed in the synthesis of pharmaceuticals, where N-(tert-butyl)-3-nitrobenzenesulfonamide is used to construct key intermediates in drug development. In pharmaceutical research, N-(tert-butyl)-3-nitrobenzenesulfonamide is particularly valuable for the development of new therapeutic agents. The sulfonamide group is known for its ability to interact with biological targets, making it a common feature in drug molecules designed to inhibit enzymes or receptors. The tert-butyl group provides steric hindrance, which can enhance the selectivity of the compound for specific biological targets, thereby reducing potential side effects. As a result, this compound is explored in the synthesis of drugs aimed at treating a variety of conditions, including bacterial infections, inflammation, and cancer. Beyond its direct use in drug synthesis, N-(tert-butyl)-3-nitrobenzenesulfonamide is also utilized in the study of reaction mechanisms. Its well-defined structure and reactivity make it an ideal candidate for investigating how sulfonamide-containing compounds interact with other chemical species. Researchers use it to understand the underlying principles of nucleophilic aromatic substitution and other reaction types, which in turn helps in the design of more efficient synthetic routes for complex molecules. Furthermore, N-(tert-butyl)-3-nitrobenzenesulfonamide finds application in materials science. The sulfonamide group can impart desirable properties to polymers and other materials, such as increased thermal stability or resistance to degradation. By incorporating this compound into polymeric materials, researchers can develop advanced materials for use in coatings, adhesives, and other industrial applications. In summary, N-(tert-butyl)-3-nitrobenzenesulfonamide is a versatile chemical compound with a wide range of applications in organic synthesis, pharmaceutical research, and materials science. Its discovery and development as a derivative of the sulfonamide class have allowed chemists to explore new avenues in drug design and material development, making it a valuable tool in both scientific research and industrial processes. References 2021. Buchwald-Hartwig reaction: an update. Monatshefte für Chemie - Chemical Monthly, 152(10). DOI: 10.1007/s00706-021-02834-3 |
| Market Analysis Reports |