| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Chembridge International Corp. Taipei / Dongguan / Nanjing | China | |||
|---|---|---|---|---|
![]() | www.chembridge.com.tw | |||
![]() | +886 (2) 2649-6320 +86 (769) 2250-4087 +86 (25) 8471-2192 | |||
![]() | +886 (2) 2704-3915 / +86 (769) 2246-8225 / +86 (25) 8471-2052 | |||
![]() | cnservice@chembridge.net | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2011 | ||||
| Jiangsu Nengyue New Material Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.jiangsunengyue.com | |||
![]() | +86 13376001577 | |||
![]() | robin@jiangsunengyue.com | |||
![]() | WhatsApp:+8613376001577 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Charkit Chemical Corp. | USA | |||
|---|---|---|---|---|
![]() | www.charkit.com | |||
![]() | +1 (203) 299-3220 | |||
![]() | +1 (203) 299-1355 | |||
![]() | salessupport@lbbspecialties.com | |||
| Chemical manufacturer since 1982 | ||||
| AK Scientific, Inc | USA | |||
|---|---|---|---|---|
![]() | www.aksci.com | |||
![]() | +1 (510) 429-8835 | |||
![]() | +1 (510) 429-8836 | |||
![]() | sales@aksci.com | |||
| Chemical manufacturer | ||||
| OChem Incorporation | USA | |||
|---|---|---|---|---|
![]() | www.ocheminc.com | |||
![]() | +1 (847) 403-7044 | |||
![]() | +1 (847) 298-5008 | |||
![]() | sales@ocheminc.com | |||
| Chemical manufacturer | ||||
| City Chemical LLC | USA | |||
|---|---|---|---|---|
![]() | www.citychemical.com | |||
![]() | +1 (203) 932-2489 | |||
![]() | +1 (203) 937-8400 | |||
![]() | sales@citychemical.com | |||
| Chemical distributor | ||||
| Classification | Organic raw materials >> Heterocyclic compound >> Triazines |
|---|---|
| Name | 2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine |
| Synonyms | 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-s-triazine; 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Cl6N3O |
| Molecular Weight | 447.96 |
| CAS Registry Number | 42573-57-9 |
| EC Number | 255-893-1 |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=NC(=NC(=N2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| Melting point | 192-195 °C |
|---|---|
| Density | 1.605 |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
|
2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine is a chemical compound known for its use in various industrial applications, particularly in the field of organic synthesis and material science. This compound belongs to the class of triazines, which are six-membered heterocycles containing three carbon atoms and three nitrogen atoms. The discovery of 2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine emerged from research into triazine derivatives with enhanced reactivity and functionality. Triazines are valued in chemistry for their ability to form stable complexes and participate in various chemical reactions. The specific substitution pattern in this compound, featuring trichloromethyl and methoxystyryl groups, imparts unique chemical properties that make it suitable for specialized applications. The synthesis of 2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine involves the introduction of trichloromethyl groups at the 2 and 4 positions of the triazine ring and a methoxystyryl group at the 6 position. The trichloromethyl groups enhance the reactivity of the triazine ring, making it a valuable intermediate in the synthesis of various organic compounds. The methoxystyryl group contributes to the compound's ability to engage in further chemical reactions, particularly in the formation of complex organic structures. In practical applications, 2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine is utilized as a key intermediate in the synthesis of pharmaceuticals and agrochemicals. Its ability to participate in diverse chemical reactions makes it a valuable building block in the development of new compounds with specific biological or chemical activities. Additionally, this compound is used in the preparation of functional materials, including dyes and polymers, where its unique chemical properties can be leveraged to achieve desired characteristics. The compound's role in organic synthesis highlights its importance in the chemical industry. By providing a means to introduce functional groups into various organic frameworks, it facilitates the development of novel compounds with potential applications across a range of fields, from medicine to materials science. Overall, 2,4-Bis(trichloromethyl)-6-(4-methoxystyryl)-1,3,5-triazine represents a significant advancement in the realm of triazine chemistry. Its applications in synthesis and material science underscore its value as a versatile and reactive chemical intermediate. References 2015. Two-cationic 2-methylbenzothiazole derivatives as green light absorbed sensitizers in initiation of free radical polymerization. Colloid and Polymer Science, 293(7). DOI: 10.1007/s00396-015-3572-1 2022. Photoinduced free radical-releasing systems and their anticancer properties. Photochemical & Photobiological Sciences, 21(7). DOI: 10.1007/s43630-022-00231-1 2023. Sensitive photoresists for high-speed two-photon lithography. Nature Nanotechnology, 18(12). DOI: 10.1038/s41565-023-01518-9 |
| Market Analysis Reports |