| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Ukrorgsyntez Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+38 (044) 531-9497 | |||
![]() |
sales@uorsy.com | |||
| Chemical manufacturer since 2001 | ||||
| Name | 2,2'-Bibenzothiazole |
|---|---|
| Synonyms | Zinc00041120; 2,2'-Bibenzothiazole; Nsc507740 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8N2S2 |
| Molecular Weight | 268.35 |
| CAS Registry Number | 4271-09-4 |
| SMILES | C1=CC=CC4=C1N=C(C2=NC3=C(S2)C=CC=C3)S4 |
| InChI | 1S/C14H8N2S2/c1-3-7-11-9(5-1)15-13(17-11)14-16-10-6-2-4-8-12(10)18-14/h1-8H |
| InChIKey | YJVXQQKAUCYQIP-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.769°C at 760 mmHg (Cal.) |
| Flash point | 220.856°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Christopher M. Fitchett, Chris Richardson and Peter J. Steel. Solid state conformations of symmetrical aromatic biheterocycles: an X-ray crystallographic investigation, Org. Biomol. Chem., 2005, 3, 498. |
|---|---|
| Market Analysis Reports |