| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | N-{[5-(Dimethylamino)-1-Naphthyl]Sulfonyl}Serine |
|---|---|
| Synonyms | Dansyl-l-serine; Dns-Ser; N-([5-(Dimethylamino)-1-naphthyl]sulfonyl)serine # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.38 |
| CAS Registry Number | 42808-14-0 |
| SMILES | O=C(O)C(NS(=O)(=O)c1cccc2c1cccc2N(C)C)CO |
| InChI | 1S/C15H18N2O5S/c1-17(2)13-7-3-6-11-10(13)5-4-8-14(11)23(21,22)16-12(9-18)15(19)20/h3-8,12,16,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | MGWCYXPXWCPETA-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.388°C at 760 mmHg (Cal.) |
| Flash point | 304.203°C (Cal.) |
| (1) | Yin Xiao, Timothy Thatt Yang Tan and Siu-Choon Ng. Enantioseparation of dansyl amino acids by ultra-high pressure liquid chromatography using cationic β-cyclodextrins as chiral additives, Analyst, 2011, 136, 1433. |
|---|---|
| Market Analysis Reports |